C21H33Cl2N3O2 — CID 42725406
N-[2-[4-(2,2-dichloroacetyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]propanamide (PubChem CID 42725406) has the molecular formula C21H33Cl2N3O2 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[2-[4-(2,2-dichloroacetyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]propanamide.
| Compound Name | N-[2-[4-(2,2-dichloroacetyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]propanamide |
|---|---|
| PubChem CID | 42725406 |
| Molecular Formula | C21H33Cl2N3O2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[2-[4-(2,2-dichloroacetyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]propanamide |
| SMILES | CCC(=O)N(CCN1CCN(C(=O)C(Cl)Cl)CC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C21H33Cl2N3O2/c1-4-18(27)26(14-15-5-6-16-13-17(15)21(16,2)3)12-9-24-7-10-25(11-8-24)20(28)19(22)23/h5,16-17,19H,4,6-14H2,1-3H3 |
| InChIKey | VKJDIBNGZADSID-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|