C18H26N4OS — CID 42730710
4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methylpropyl)butanamide (PubChem CID 42730710) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methylpropyl)butanamide.
| Compound Name | 4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 42730710 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methylpropyl)butanamide |
| SMILES | CCn1c(SCCCC(=O)NCC(C)C)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H26N4OS/c1-4-22-17(15-9-6-5-7-10-15)20-21-18(22)24-12-8-11-16(23)19-13-14(2)3/h5-7,9-10,14H,4,8,11-13H2,1-3H3,(H,19,23) |
| InChIKey | KXBKTYYHCFKCSN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|