C21H17BrClNO5 — CID 4273097
ethyl 2-[2-(4-bromophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetate (PubChem CID 4273097) has the molecular formula C21H17BrClNO5 and a molecular weight of 478.73 g/mol. Its IUPAC name is ethyl 2-[2-(4-bromophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetate.
| Compound Name | ethyl 2-[2-(4-bromophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 4273097 |
| Molecular Formula | C21H17BrClNO5 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | ethyl 2-[2-(4-bromophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)C(=C(O)c2ccc(Cl)cc2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H17BrClNO5/c1-2-29-16(25)11-24-18(12-3-7-14(22)8-4-12)17(20(27)21(24)28)19(26)13-5-9-15(23)10-6-13/h3-10,18,26H,2,11H2,1H3 |
| InChIKey | XFDWNORRQYDTIN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|