C15H24N4O3S — CID 42739010
2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 42739010) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 42739010 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-(4-ethyl-1-methyl-6-oxopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CCc1cc(=O)n(C)c(SCC(=O)NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C15H24N4O3S/c1-3-12-10-14(21)18(2)15(17-12)23-11-13(20)16-4-5-19-6-8-22-9-7-19/h10H,3-9,11H2,1-2H3,(H,16,20) |
| InChIKey | MUVJZKWWLATYJJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |