C21H19Cl2N3O — CID 42741062
1-(3,4-dichlorophenyl)-N-phenyl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide (PubChem CID 42741062) has the molecular formula C21H19Cl2N3O and a molecular weight of 400.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-phenyl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-phenyl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 42741062 |
| Molecular Formula | C21H19Cl2N3O |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-phenyl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCn2cccc2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O/c22-17-10-9-15(14-18(17)23)20-19-8-4-11-25(19)12-5-13-26(20)21(27)24-16-6-2-1-3-7-16/h1-4,6-11,14,20H,5,12-13H2,(H,24,27) |
| InChIKey | UHNCDLJUCYEUPX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |