C23H18ClF6N3O — CID 4568072
N-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide (PubChem CID 4568072) has the molecular formula C23H18ClF6N3O and a molecular weight of 501.86 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 4568072 |
| Molecular Formula | C23H18ClF6N3O |
| Molecular Weight | 501.86 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(3-chlorophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCCn2cccc2C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClF6N3O/c24-17-5-1-4-14(10-17)20-19-6-2-7-32(19)8-3-9-33(20)21(34)31-18-12-15(22(25,26)27)11-16(13-18)23(28,29)30/h1-2,4-7,10-13,20H,3,8-9H2,(H,31,34) |
| InChIKey | SKGRSUAVFNXUNW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.86 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |