C19H17Cl2N3OS — CID 42742151
N-(2,4-dichlorophenyl)-1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide (PubChem CID 42742151) has the molecular formula C19H17Cl2N3OS and a molecular weight of 406.34 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 42742151 |
| Molecular Formula | C19H17Cl2N3OS |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)N1CCCn2cccc2C1c1ccsc1 |
| InChI | InChI=1S/C19H17Cl2N3OS/c20-14-4-5-16(15(21)11-14)22-19(25)24-9-2-8-23-7-1-3-17(23)18(24)13-6-10-26-12-13/h1,3-7,10-12,18H,2,8-9H2,(H,22,25) |
| InChIKey | YPAQBPUODKNOKU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |