C22H23N3O3S — CID 42742149
ethyl 4-[(1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carbonyl)amino]benzoate (PubChem CID 42742149) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 4-[(1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 42742149 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | ethyl 4-[(1-thiophen-3-yl-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCCn3cccc3C2c2ccsc2)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-2-28-21(26)16-6-8-18(9-7-16)23-22(27)25-13-4-12-24-11-3-5-19(24)20(25)17-10-14-29-15-17/h3,5-11,14-15,20H,2,4,12-13H2,1H3,(H,23,27) |
| InChIKey | VLKPMOXHTKKNFU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |