C24H17F9N2O — CID 3321894
[3,5-bis(trifluoromethyl)phenyl]-[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone (PubChem CID 3321894) has the molecular formula C24H17F9N2O and a molecular weight of 520.40 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone |
|---|---|
| PubChem CID | 3321894 |
| Molecular Formula | C24H17F9N2O |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[1-[4-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCCn2cccc2C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H17F9N2O/c25-22(26,27)16-6-4-14(5-7-16)20-19-3-1-8-34(19)9-2-10-35(20)21(36)15-11-17(23(28,29)30)13-18(12-15)24(31,32)33/h1,3-8,11-13,20H,2,9-10H2 |
| InChIKey | ZIFYTGSZFHDGGQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |