C29H26F3N3O2 — CID 42742140
1-(4-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide (PubChem CID 42742140) has the molecular formula C29H26F3N3O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is 1-(4-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide.
| Compound Name | 1-(4-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 42742140 |
| Molecular Formula | C29H26F3N3O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-(4-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N1CCCn2cccc2C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26F3N3O2/c30-29(31,32)23-9-4-10-24(19-23)33-28(36)35-18-6-17-34-16-5-11-26(34)27(35)22-12-14-25(15-13-22)37-20-21-7-2-1-3-8-21/h1-5,7-16,19,27H,6,17-18,20H2,(H,33,36) |
| InChIKey | MYFOCFGCFPTSLB-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |