C23H22Cl2N2O2 — CID 42742112
2,2-dichloro-1-[1-(4-phenylmethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]ethanone (PubChem CID 42742112) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 2,2-dichloro-1-[1-(4-phenylmethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[1-(4-phenylmethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]ethanone |
|---|---|
| PubChem CID | 42742112 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2,2-dichloro-1-[1-(4-phenylmethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]ethanone |
| SMILES | O=C(C(Cl)Cl)N1CCCn2cccc2C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O2/c24-22(25)23(28)27-15-5-14-26-13-4-8-20(26)21(27)18-9-11-19(12-10-18)29-16-17-6-2-1-3-7-17/h1-4,6-13,21-22H,5,14-16H2 |
| InChIKey | DUQOULBNELSSMM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|