C23H23N3O4 — CID 4694670
1-[1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-2-phenylmethoxyethanone (PubChem CID 4694670) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-[1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 4694670 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-2-phenylmethoxyethanone |
| SMILES | O=C(COCc1ccccc1)N1CCCn2cccc2C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N3O4/c27-22(17-30-16-18-8-2-1-3-9-18)25-15-7-14-24-13-6-12-21(24)23(25)19-10-4-5-11-20(19)26(28)29/h1-6,8-13,23H,7,14-17H2 |
| InChIKey | GJSIMPRAWPNQFR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|