C20H19N3O2 — CID 51939439
(1R)-2-[(2-nitrophenyl)methyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 51939439) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (1R)-2-[(2-nitrophenyl)methyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1R)-2-[(2-nitrophenyl)methyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 51939439 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (1R)-2-[(2-nitrophenyl)methyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | O=[N+]([O-])c1ccccc1CN1CCn2cccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c24-23(25)18-10-5-4-9-17(18)15-22-14-13-21-12-6-11-19(21)20(22)16-7-2-1-3-8-16/h1-12,20H,13-15H2/t20-/m1/s1 |
| InChIKey | HUQIJNFZLJYHSP-HXUWFJFHSA-N |
| XLogP | 4.00 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|