C21H21N3O2 — CID 52680632
(1S)-2-[2-(4-nitrophenyl)ethyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 52680632) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (1S)-2-[2-(4-nitrophenyl)ethyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S)-2-[2-(4-nitrophenyl)ethyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 52680632 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (1S)-2-[2-(4-nitrophenyl)ethyl]-1-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | O=[N+]([O-])c1ccc(CCN2CCn3cccc3[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N3O2/c25-24(26)19-10-8-17(9-11-19)12-14-23-16-15-22-13-4-7-20(22)21(23)18-5-2-1-3-6-18/h1-11,13,21H,12,14-16H2/t21-/m0/s1 |
| InChIKey | CUIWBHOQXDZJJM-NRFANRHFSA-N |
| XLogP | 4.04 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|