C21H19F2N3O2 — CID 93323172
(1S)-2-[(2,6-difluorophenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 93323172) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is (1S)-2-[(2,6-difluorophenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (1S)-2-[(2,6-difluorophenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 93323172 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (1S)-2-[(2,6-difluorophenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | O=[N+]([O-])c1ccccc1[C@H]1c2cccn2CCCN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C21H19F2N3O2/c22-17-7-3-8-18(23)16(17)14-25-13-5-12-24-11-4-10-20(24)21(25)15-6-1-2-9-19(15)26(27)28/h1-4,6-11,21H,5,12-14H2/t21-/m0/s1 |
| InChIKey | KIIKKGCVQQVCEL-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|