C23H25N3O4 — CID 93231844
(1R)-2-[(3,5-dimethoxyphenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 93231844) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (1R)-2-[(3,5-dimethoxyphenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (1R)-2-[(3,5-dimethoxyphenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 93231844 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (1R)-2-[(3,5-dimethoxyphenyl)methyl]-1-(2-nitrophenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | COc1cc(CN2CCCn3cccc3[C@H]2c2ccccc2[N+](=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-29-18-13-17(14-19(15-18)30-2)16-25-12-6-11-24-10-5-9-22(24)23(25)20-7-3-4-8-21(20)26(27)28/h3-5,7-10,13-15,23H,6,11-12,16H2,1-2H3/t23-/m1/s1 |
| InChIKey | LTKRASHWUHSFHL-HSZRJFAPSA-N |
| XLogP | 4.41 |
| TPSA | 69.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|