C18H22ClN3O — CID 42743654
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methylcyclobutanecarboxamide (PubChem CID 42743654) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methylcyclobutanecarboxamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 42743654 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-N-methylcyclobutanecarboxamide |
| SMILES | CN(CCCNc1ccnc2cc(Cl)ccc12)C(=O)C1CCC1 |
| InChI | InChI=1S/C18H22ClN3O/c1-22(18(23)13-4-2-5-13)11-3-9-20-16-8-10-21-17-12-14(19)6-7-15(16)17/h6-8,10,12-13H,2-5,9,11H2,1H3,(H,20,21) |
| InChIKey | XKQOAIYBRBYUDA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|