C21H27N3O4S — CID 42745438
1-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazolidin-3-yl]-3-methylbut-2-en-1-one (PubChem CID 42745438) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazolidin-3-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazolidin-3-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 42745438 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazolidin-3-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CSCC1C(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H27N3O4S/c1-15(2)9-20(25)24-13-29-12-17(24)21(26)23-7-5-22(6-8-23)11-16-3-4-18-19(10-16)28-14-27-18/h3-4,9-10,17H,5-8,11-14H2,1-2H3 |
| InChIKey | ZFSKUEFOUXMISY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|