C16H15N3O — CID 42748352
3-cyano-N-cyclopropyl-1-(3-methylphenyl)pyrrole-2-carboxamide (PubChem CID 42748352) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-cyano-N-cyclopropyl-1-(3-methylphenyl)pyrrole-2-carboxamide.
| Compound Name | 3-cyano-N-cyclopropyl-1-(3-methylphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 42748352 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-cyano-N-cyclopropyl-1-(3-methylphenyl)pyrrole-2-carboxamide |
| SMILES | Cc1cccc(-n2ccc(C#N)c2C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C16H15N3O/c1-11-3-2-4-14(9-11)19-8-7-12(10-17)15(19)16(20)18-13-5-6-13/h2-4,7-9,13H,5-6H2,1H3,(H,18,20) |
| InChIKey | UBIJNLLIMNNABX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |