C21H19N3O — CID 809837
N-benzyl-3-cyano-1-(3,4-dimethylphenyl)pyrrole-2-carboxamide (PubChem CID 809837) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is N-benzyl-3-cyano-1-(3,4-dimethylphenyl)pyrrole-2-carboxamide.
| Compound Name | N-benzyl-3-cyano-1-(3,4-dimethylphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 809837 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-benzyl-3-cyano-1-(3,4-dimethylphenyl)pyrrole-2-carboxamide |
| SMILES | Cc1ccc(-n2ccc(C#N)c2C(=O)NCc2ccccc2)cc1C |
| InChI | InChI=1S/C21H19N3O/c1-15-8-9-19(12-16(15)2)24-11-10-18(13-22)20(24)21(25)23-14-17-6-4-3-5-7-17/h3-12H,14H2,1-2H3,(H,23,25) |
| InChIKey | KUAWHKMJRGKKKP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |