C20H16BrN3O — CID 4236090
1-(3-bromophenyl)-3-cyano-N-(2-phenylethyl)pyrrole-2-carboxamide (PubChem CID 4236090) has the molecular formula C20H16BrN3O and a molecular weight of 394.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-cyano-N-(2-phenylethyl)pyrrole-2-carboxamide.
| Compound Name | 1-(3-bromophenyl)-3-cyano-N-(2-phenylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 4236090 |
| Molecular Formula | C20H16BrN3O |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-(3-bromophenyl)-3-cyano-N-(2-phenylethyl)pyrrole-2-carboxamide |
| SMILES | N#Cc1ccn(-c2cccc(Br)c2)c1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H16BrN3O/c21-17-7-4-8-18(13-17)24-12-10-16(14-22)19(24)20(25)23-11-9-15-5-2-1-3-6-15/h1-8,10,12-13H,9,11H2,(H,23,25) |
| InChIKey | XHMXYUKQCMIWTQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |