C18H23N4O+ — CID 7124123
2-[[3-cyano-1-(2-ethylphenyl)pyrrole-2-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 7124123) has the molecular formula C18H23N4O+ and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[[3-cyano-1-(2-ethylphenyl)pyrrole-2-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[3-cyano-1-(2-ethylphenyl)pyrrole-2-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7124123 |
| Molecular Formula | C18H23N4O+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[[3-cyano-1-(2-ethylphenyl)pyrrole-2-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | CCc1ccccc1-n1ccc(C#N)c1C(=O)NCC[NH+](C)C |
| InChI | InChI=1S/C18H22N4O/c1-4-14-7-5-6-8-16(14)22-11-9-15(13-19)17(22)18(23)20-10-12-21(2)3/h5-9,11H,4,10,12H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | RAJRNOMMUPBFMT-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 62.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |