C24H18N4O — CID 42748986
3-cyano-1-(2-phenylphenyl)-N-(pyridin-4-ylmethyl)pyrrole-2-carboxamide (PubChem CID 42748986) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-cyano-1-(2-phenylphenyl)-N-(pyridin-4-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 3-cyano-1-(2-phenylphenyl)-N-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 42748986 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-cyano-1-(2-phenylphenyl)-N-(pyridin-4-ylmethyl)pyrrole-2-carboxamide |
| SMILES | N#Cc1ccn(-c2ccccc2-c2ccccc2)c1C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C24H18N4O/c25-16-20-12-15-28(23(20)24(29)27-17-18-10-13-26-14-11-18)22-9-5-4-8-21(22)19-6-2-1-3-7-19/h1-15H,17H2,(H,27,29) |
| InChIKey | OKQRAWGNHUMUGG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |