C23H23N3O — CID 5145646
3-cyano-N-(3-methylbutyl)-1-(2-phenylphenyl)pyrrole-2-carboxamide (PubChem CID 5145646) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-cyano-N-(3-methylbutyl)-1-(2-phenylphenyl)pyrrole-2-carboxamide.
| Compound Name | 3-cyano-N-(3-methylbutyl)-1-(2-phenylphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 5145646 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-cyano-N-(3-methylbutyl)-1-(2-phenylphenyl)pyrrole-2-carboxamide |
| SMILES | CC(C)CCNC(=O)c1c(C#N)ccn1-c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H23N3O/c1-17(2)12-14-25-23(27)22-19(16-24)13-15-26(22)21-11-7-6-10-20(21)18-8-4-3-5-9-18/h3-11,13,15,17H,12,14H2,1-2H3,(H,25,27) |
| InChIKey | RNJLWEATAQGXHB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |