C15H13F2N3O2 — CID 3902580
3-cyano-1-(2,5-difluorophenyl)-N-(2-methoxyethyl)pyrrole-2-carboxamide (PubChem CID 3902580) has the molecular formula C15H13F2N3O2 and a molecular weight of 305.28 g/mol. Its IUPAC name is 3-cyano-1-(2,5-difluorophenyl)-N-(2-methoxyethyl)pyrrole-2-carboxamide.
| Compound Name | 3-cyano-1-(2,5-difluorophenyl)-N-(2-methoxyethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3902580 |
| Molecular Formula | C15H13F2N3O2 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-cyano-1-(2,5-difluorophenyl)-N-(2-methoxyethyl)pyrrole-2-carboxamide |
| SMILES | COCCNC(=O)c1c(C#N)ccn1-c1cc(F)ccc1F |
| InChI | InChI=1S/C15H13F2N3O2/c1-22-7-5-19-15(21)14-10(9-18)4-6-20(14)13-8-11(16)2-3-12(13)17/h2-4,6,8H,5,7H2,1H3,(H,19,21) |
| InChIKey | CXENNFNQVFLBST-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|