C19H15FN4O — CID 809823
3-cyano-1-(4-fluorophenyl)-N-(2-pyridin-2-ylethyl)pyrrole-2-carboxamide (PubChem CID 809823) has the molecular formula C19H15FN4O and a molecular weight of 334.35 g/mol. Its IUPAC name is 3-cyano-1-(4-fluorophenyl)-N-(2-pyridin-2-ylethyl)pyrrole-2-carboxamide.
| Compound Name | 3-cyano-1-(4-fluorophenyl)-N-(2-pyridin-2-ylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 809823 |
| Molecular Formula | C19H15FN4O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-cyano-1-(4-fluorophenyl)-N-(2-pyridin-2-ylethyl)pyrrole-2-carboxamide |
| SMILES | N#Cc1ccn(-c2ccc(F)cc2)c1C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C19H15FN4O/c20-15-4-6-17(7-5-15)24-12-9-14(13-21)18(24)19(25)23-11-8-16-3-1-2-10-22-16/h1-7,9-10,12H,8,11H2,(H,23,25) |
| InChIKey | AHHVAXRJTURLDA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |