C26H25N3OS — CID 42749891
[4-(2-methylphenyl)piperazin-1-yl]-(6-methyl-2-thiophen-3-ylquinolin-4-yl)methanone (PubChem CID 42749891) has the molecular formula C26H25N3OS and a molecular weight of 427.57 g/mol. Its IUPAC name is [4-(2-methylphenyl)piperazin-1-yl]-(6-methyl-2-thiophen-3-ylquinolin-4-yl)methanone.
| Compound Name | [4-(2-methylphenyl)piperazin-1-yl]-(6-methyl-2-thiophen-3-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 42749891 |
| Molecular Formula | C26H25N3OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | [4-(2-methylphenyl)piperazin-1-yl]-(6-methyl-2-thiophen-3-ylquinolin-4-yl)methanone |
| SMILES | Cc1ccc2nc(-c3ccsc3)cc(C(=O)N3CCN(c4ccccc4C)CC3)c2c1 |
| InChI | InChI=1S/C26H25N3OS/c1-18-7-8-23-21(15-18)22(16-24(27-23)20-9-14-31-17-20)26(30)29-12-10-28(11-13-29)25-6-4-3-5-19(25)2/h3-9,14-17H,10-13H2,1-2H3 |
| InChIKey | KJRDOLOLWDVGGF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |