C17H16N6O7 — CID 4275309
4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxopropan-2-yl]benzohydrazide (PubChem CID 4275309) has the molecular formula C17H16N6O7 and a molecular weight of 416.35 g/mol. Its IUPAC name is 4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxopropan-2-yl]benzohydrazide.
| Compound Name | 4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxopropan-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 4275309 |
| Molecular Formula | C17H16N6O7 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxopropan-2-yl]benzohydrazide |
| SMILES | CC(NNC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N6O7/c1-10(18-20-16(25)11-2-6-13(7-3-11)22(27)28)15(24)19-21-17(26)12-4-8-14(9-5-12)23(29)30/h2-10,18H,1H3,(H,19,24)(H,20,25)(H,21,26) |
| InChIKey | IYISASBAXTWGJN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|