C18H18N6O7 — CID 4592576
4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzohydrazide (PubChem CID 4592576) has the molecular formula C18H18N6O7 and a molecular weight of 430.38 g/mol. Its IUPAC name is 4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzohydrazide.
| Compound Name | 4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 4592576 |
| Molecular Formula | C18H18N6O7 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-nitro-N'-[1-[2-(4-nitrobenzoyl)hydrazinyl]-1-oxobutan-2-yl]benzohydrazide |
| SMILES | CCC(NNC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N6O7/c1-2-15(19-20-16(25)11-3-7-13(8-4-11)23(28)29)18(27)22-21-17(26)12-5-9-14(10-6-12)24(30)31/h3-10,15,19H,2H2,1H3,(H,20,25)(H,21,26)(H,22,27) |
| InChIKey | SREZMKBORYZXPU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|