C40H54N2O8 — CID 4275334
benzyl N-[12-ethoxyimino-4-hydroxy-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate (PubChem CID 4275334) has the molecular formula C40H54N2O8 and a molecular weight of 690.88 g/mol. Its IUPAC name is benzyl N-[12-ethoxyimino-4-hydroxy-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate.
| Compound Name | benzyl N-[12-ethoxyimino-4-hydroxy-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 4275334 |
| Molecular Formula | C40H54N2O8 |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | benzyl N-[12-ethoxyimino-4-hydroxy-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCC)CC1N(CCC)C(=O)OCc1ccccc1)C32 |
| InChI | InChI=1S/C40H54N2O8/c1-4-20-42(39(46)47-27-28-14-8-7-9-15-28)36-26-34(41-49-6-3)32-24-29(16-10-12-21-43)31(17-11-13-22-44)37-33-25-30(45)18-19-35(33)50-40(36,38(32)37)48-23-5-2/h5,7-9,14-15,18-19,24-25,29,31,36-38,43-45H,2,4,6,10-13,16-17,20-23,26-27H2,1,3H3 |
| InChIKey | FAWLRGPVJSJMJQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|