C37H48N2O8 — CID 3943402
methyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate (PubChem CID 3943402) has the molecular formula C37H48N2O8 and a molecular weight of 648.80 g/mol. Its IUPAC name is methyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate.
| Compound Name | methyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 3943402 |
| Molecular Formula | C37H48N2O8 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | methyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCc4ccccc4)CC1N(C)C(=O)OC)C32 |
| InChI | InChI=1S/C37H48N2O8/c1-4-20-45-37-33(39(2)36(43)44-3)23-31(38-46-24-25-12-6-5-7-13-25)29-21-26(14-8-10-18-40)28(15-9-11-19-41)34(35(29)37)30-22-27(42)16-17-32(30)47-37/h4-7,12-13,16-17,21-22,26,28,33-35,40-42H,1,8-11,14-15,18-20,23-24H2,2-3H3 |
| InChIKey | MKNJBFPTQMFQCJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|