C38H49ClN2O8 — CID 3594645
2-chloroethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate (PubChem CID 3594645) has the molecular formula C38H49ClN2O8 and a molecular weight of 697.27 g/mol. Its IUPAC name is 2-chloroethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate.
| Compound Name | 2-chloroethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 3594645 |
| Molecular Formula | C38H49ClN2O8 |
| Molecular Weight | 697.27 g/mol |
| Exact Mass | 696.32 |
| IUPAC Name | 2-chloroethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCc4ccccc4)CC1N(C)C(=O)OCCCl)C32 |
| InChI | InChI=1S/C38H49ClN2O8/c1-3-20-47-38-34(41(2)37(45)46-21-17-39)24-32(40-48-25-26-11-5-4-6-12-26)30-22-27(13-7-9-18-42)29(14-8-10-19-43)35(36(30)38)31-23-28(44)15-16-33(31)49-38/h3-6,11-12,15-16,22-23,27,29,34-36,42-44H,1,7-10,13-14,17-21,24-25H2,2H3 |
| InChIKey | YIFKYVTWEVLVQP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.27 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|