C38H49N3O10 — CID 3604353
ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-[(4-nitrophenyl)methoxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate (PubChem CID 3604353) has the molecular formula C38H49N3O10 and a molecular weight of 707.82 g/mol. Its IUPAC name is ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-[(4-nitrophenyl)methoxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate.
| Compound Name | ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-[(4-nitrophenyl)methoxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 3604353 |
| Molecular Formula | C38H49N3O10 |
| Molecular Weight | 707.82 g/mol |
| Exact Mass | 707.34 |
| IUPAC Name | ethyl N-[4-hydroxy-15,16-bis(4-hydroxybutyl)-12-[(4-nitrophenyl)methoxyimino]-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-methylcarbamate |
| SMILES | C=CCOC12Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCc4ccc([N+](=O)[O-])cc4)CC1N(C)C(=O)OCC)C32 |
| InChI | InChI=1S/C38H49N3O10/c1-4-20-49-38-34(40(3)37(45)48-5-2)23-32(39-50-24-25-12-14-27(15-13-25)41(46)47)30-21-26(10-6-8-18-42)29(11-7-9-19-43)35(36(30)38)31-22-28(44)16-17-33(31)51-38/h4,12-17,21-22,26,29,34-36,42-44H,1,5-11,18-20,23-24H2,2-3H3 |
| InChIKey | IYWKXHVVPPLSFO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|