C24H20Cl2N6O3S — CID 42753423
1-[[4-(2,4-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea (PubChem CID 42753423) has the molecular formula C24H20Cl2N6O3S and a molecular weight of 543.44 g/mol. Its IUPAC name is 1-[[4-(2,4-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[[4-(2,4-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42753423 |
| Molecular Formula | C24H20Cl2N6O3S |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 1-[[4-(2,4-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea |
| SMILES | Cc1ccccc1CSc1nnc(CNC(=O)Nc2ccc([N+](=O)[O-])cc2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20Cl2N6O3S/c1-15-4-2-3-5-16(15)14-36-24-30-29-22(31(24)21-11-6-17(25)12-20(21)26)13-27-23(33)28-18-7-9-19(10-8-18)32(34)35/h2-12H,13-14H2,1H3,(H2,27,28,33) |
| InChIKey | OSWZVJWEHQVDLI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|