C25H22ClN3O — CID 42759545
3-(2-chlorophenyl)-N-(1,2-diphenylethyl)-1-methylpyrazole-5-carboxamide (PubChem CID 42759545) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(1,2-diphenylethyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-(1,2-diphenylethyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42759545 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(1,2-diphenylethyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccccc2Cl)cc1C(=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22ClN3O/c1-29-24(17-23(28-29)20-14-8-9-15-21(20)26)25(30)27-22(19-12-6-3-7-13-19)16-18-10-4-2-5-11-18/h2-15,17,22H,16H2,1H3,(H,27,30) |
| InChIKey | BNHBVTGGKWYBEK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |