C12H20N2O2 — CID 42759988
2-methoxy-N-[(1-methylpyrrol-2-yl)methyl]-N-propylacetamide (PubChem CID 42759988) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-methoxy-N-[(1-methylpyrrol-2-yl)methyl]-N-propylacetamide.
| Compound Name | 2-methoxy-N-[(1-methylpyrrol-2-yl)methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 42759988 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-methoxy-N-[(1-methylpyrrol-2-yl)methyl]-N-propylacetamide |
| SMILES | CCCN(Cc1cccn1C)C(=O)COC |
| InChI | InChI=1S/C12H20N2O2/c1-4-7-14(12(15)10-16-3)9-11-6-5-8-13(11)2/h5-6,8H,4,7,9-10H2,1-3H3 |
| InChIKey | FJPCYPVUPUVTEK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |