C18H14Cl2N4O5S — CID 42765453
5-[1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-2-yl]-3-(4-chlorophenyl)-1,2,4-oxadiazole (PubChem CID 42765453) has the molecular formula C18H14Cl2N4O5S and a molecular weight of 469.31 g/mol. Its IUPAC name is 5-[1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-2-yl]-3-(4-chlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-2-yl]-3-(4-chlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42765453 |
| Molecular Formula | C18H14Cl2N4O5S |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 5-[1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-2-yl]-3-(4-chlorophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2c2nc(-c3ccc(Cl)cc3)no2)ccc1Cl |
| InChI | InChI=1S/C18H14Cl2N4O5S/c19-12-5-3-11(4-6-12)17-21-18(29-22-17)15-2-1-9-23(15)30(27,28)13-7-8-14(20)16(10-13)24(25)26/h3-8,10,15H,1-2,9H2 |
| InChIKey | SLVUVWHXJBGWQJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|