C14H14N4O4S — CID 42765712
N-methyl-2-[[methyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 42765712) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is N-methyl-2-[[methyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-methyl-2-[[methyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42765712 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-methyl-2-[[methyl-(4-nitrobenzoyl)amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(CN(C)C(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C14H14N4O4S/c1-15-13(19)11-8-23-12(16-11)7-17(2)14(20)9-3-5-10(6-4-9)18(21)22/h3-6,8H,7H2,1-2H3,(H,15,19) |
| InChIKey | VNVXYBIXDGNVRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|