C22H31N3O4 — CID 42766154
2-[[(4-butoxybenzoyl)-propan-2-ylamino]methyl]-N-propan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 42766154) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[[(4-butoxybenzoyl)-propan-2-ylamino]methyl]-N-propan-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(4-butoxybenzoyl)-propan-2-ylamino]methyl]-N-propan-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42766154 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 2-[[(4-butoxybenzoyl)-propan-2-ylamino]methyl]-N-propan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2nc(C(=O)NC(C)C)co2)C(C)C)cc1 |
| InChI | InChI=1S/C22H31N3O4/c1-6-7-12-28-18-10-8-17(9-11-18)22(27)25(16(4)5)13-20-24-19(14-29-20)21(26)23-15(2)3/h8-11,14-16H,6-7,12-13H2,1-5H3,(H,23,26) |
| InChIKey | SRXHKSCOPVMMRX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|