C21H30N4O4S — CID 42774162
3-N-(1,3-benzodioxol-5-ylmethyl)-8-N-butyl-1-thia-4,8-diazaspiro[4.5]decane-3,8-dicarboxamide (PubChem CID 42774162) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-ylmethyl)-8-N-butyl-1-thia-4,8-diazaspiro[4.5]decane-3,8-dicarboxamide.
| Compound Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-8-N-butyl-1-thia-4,8-diazaspiro[4.5]decane-3,8-dicarboxamide |
|---|---|
| PubChem CID | 42774162 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-8-N-butyl-1-thia-4,8-diazaspiro[4.5]decane-3,8-dicarboxamide |
| SMILES | CCCCNC(=O)N1CCC2(CC1)NC(C(=O)NCc1ccc3c(c1)OCO3)CS2 |
| InChI | InChI=1S/C21H30N4O4S/c1-2-3-8-22-20(27)25-9-6-21(7-10-25)24-16(13-30-21)19(26)23-12-15-4-5-17-18(11-15)29-14-28-17/h4-5,11,16,24H,2-3,6-10,12-14H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | MWFQSIWJKKJLPG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|