C27H23FN2O2S — CID 42774275
3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(furan-2-ylmethyl)-3-thiophen-3-ylpropanamide (PubChem CID 42774275) has the molecular formula C27H23FN2O2S and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(furan-2-ylmethyl)-3-thiophen-3-ylpropanamide.
| Compound Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(furan-2-ylmethyl)-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 42774275 |
| Molecular Formula | C27H23FN2O2S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(furan-2-ylmethyl)-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CC(c1ccsc1)c1cn(Cc2ccc(F)cc2)c2ccccc12)NCc1ccco1 |
| InChI | InChI=1S/C27H23FN2O2S/c28-21-9-7-19(8-10-21)16-30-17-25(23-5-1-2-6-26(23)30)24(20-11-13-33-18-20)14-27(31)29-15-22-4-3-12-32-22/h1-13,17-18,24H,14-16H2,(H,29,31) |
| InChIKey | IMPBMCBAXRTGDC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |