C18H18BrN3OS — CID 4277554
5-(4-bromophenyl)-3-(4-methoxyphenyl)-N-methyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 4277554) has the molecular formula C18H18BrN3OS and a molecular weight of 404.33 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(4-methoxyphenyl)-N-methyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-bromophenyl)-3-(4-methoxyphenyl)-N-methyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 4277554 |
| Molecular Formula | C18H18BrN3OS |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5-(4-bromophenyl)-3-(4-methoxyphenyl)-N-methyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CNC(=S)N1N=C(c2ccc(Br)cc2)CC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18BrN3OS/c1-20-18(24)22-17(13-5-9-15(23-2)10-6-13)11-16(21-22)12-3-7-14(19)8-4-12/h3-10,17H,11H2,1-2H3,(H,20,24) |
| InChIKey | JYSYYGJGTRDDKP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|