C19H21N3OS — CID 46842884
5-(3,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 46842884) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(3,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 46842884 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3-(4-methoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | COc1ccc(C2CC(c3ccc(C)c(C)c3)=NN2C(N)=S)cc1 |
| InChI | InChI=1S/C19H21N3OS/c1-12-4-5-15(10-13(12)2)17-11-18(22(21-17)19(20)24)14-6-8-16(23-3)9-7-14/h4-10,18H,11H2,1-3H3,(H2,20,24) |
| InChIKey | DHEZMKZYJNFVFC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|