C23H27N7O3S — CID 42777031
1-[2-[4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3-(4-nitrophenyl)urea (PubChem CID 42777031) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 1-[2-[4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-[4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42777031 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 1-[2-[4-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3-(4-nitrophenyl)urea |
| SMILES | Cc1ccc(Cc2nsc(N3CCN(CCNC(=O)Nc4ccc([N+](=O)[O-])cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H27N7O3S/c1-17-2-4-18(5-3-17)16-21-26-23(34-27-21)29-14-12-28(13-15-29)11-10-24-22(31)25-19-6-8-20(9-7-19)30(32)33/h2-9H,10-16H2,1H3,(H2,24,25,31) |
| InChIKey | BPVPBLALPTXHCW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|