C22H22ClN7O5S — CID 4046372
N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3,5-dinitrobenzamide (PubChem CID 4046372) has the molecular formula C22H22ClN7O5S and a molecular weight of 531.98 g/mol. Its IUPAC name is N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4046372 |
| Molecular Formula | C22H22ClN7O5S |
| Molecular Weight | 531.98 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCCN1CCN(c2nc(Cc3ccc(Cl)cc3)ns2)CC1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22ClN7O5S/c23-17-3-1-15(2-4-17)11-20-25-22(36-26-20)28-9-7-27(8-10-28)6-5-24-21(31)16-12-18(29(32)33)14-19(13-16)30(34)35/h1-4,12-14H,5-11H2,(H,24,31) |
| InChIKey | AKOHHOLVYKXPBI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.98 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|