C27H34ClN5OS — CID 3945231
N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-4-pentylbenzamide (PubChem CID 3945231) has the molecular formula C27H34ClN5OS and a molecular weight of 512.12 g/mol. Its IUPAC name is N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-4-pentylbenzamide.
| Compound Name | N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 3945231 |
| Molecular Formula | C27H34ClN5OS |
| Molecular Weight | 512.12 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | N-[2-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCCN2CCN(c3nc(Cc4ccc(Cl)cc4)ns3)CC2)cc1 |
| InChI | InChI=1S/C27H34ClN5OS/c1-2-3-4-5-21-6-10-23(11-7-21)26(34)29-14-15-32-16-18-33(19-17-32)27-30-25(31-35-27)20-22-8-12-24(28)13-9-22/h6-13H,2-5,14-20H2,1H3,(H,29,34) |
| InChIKey | BZXADEKOHNICSE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.12 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|