C26H31ClN4OS — CID 3944440
[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone (PubChem CID 3944440) has the molecular formula C26H31ClN4OS and a molecular weight of 483.08 g/mol. Its IUPAC name is [4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone.
| Compound Name | [4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 3944440 |
| Molecular Formula | C26H31ClN4OS |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCCN(c3nc(Cc4ccc(Cl)cc4)ns3)CC2)cc1 |
| InChI | InChI=1S/C26H31ClN4OS/c1-2-3-4-6-20-7-11-22(12-8-20)25(32)30-15-5-16-31(18-17-30)26-28-24(29-33-26)19-21-9-13-23(27)14-10-21/h7-14H,2-6,15-19H2,1H3 |
| InChIKey | STALAQLUXDNNGT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|