C22H33ClN4O2S2 — CID 4042221
3-[(4-chlorophenyl)methyl]-5-(4-octylsulfonyl-1,4-diazepan-1-yl)-1,2,4-thiadiazole (PubChem CID 4042221) has the molecular formula C22H33ClN4O2S2 and a molecular weight of 485.12 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-5-(4-octylsulfonyl-1,4-diazepan-1-yl)-1,2,4-thiadiazole.
| Compound Name | 3-[(4-chlorophenyl)methyl]-5-(4-octylsulfonyl-1,4-diazepan-1-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 4042221 |
| Molecular Formula | C22H33ClN4O2S2 |
| Molecular Weight | 485.12 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-5-(4-octylsulfonyl-1,4-diazepan-1-yl)-1,2,4-thiadiazole |
| SMILES | CCCCCCCCS(=O)(=O)N1CCCN(c2nc(Cc3ccc(Cl)cc3)ns2)CC1 |
| InChI | InChI=1S/C22H33ClN4O2S2/c1-2-3-4-5-6-7-17-31(28,29)27-14-8-13-26(15-16-27)22-24-21(25-30-22)18-19-9-11-20(23)12-10-19/h9-12H,2-8,13-18H2,1H3 |
| InChIKey | MZHAWXABTPJQOX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.12 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|