C26H40N4O2S — CID 5071054
2,4-dimethyl-5-[(4-methylphenyl)methyl]-6-(4-octylsulfonylpiperazin-1-yl)pyrimidine (PubChem CID 5071054) has the molecular formula C26H40N4O2S and a molecular weight of 472.70 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(4-methylphenyl)methyl]-6-(4-octylsulfonylpiperazin-1-yl)pyrimidine.
| Compound Name | 2,4-dimethyl-5-[(4-methylphenyl)methyl]-6-(4-octylsulfonylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 5071054 |
| Molecular Formula | C26H40N4O2S |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 2,4-dimethyl-5-[(4-methylphenyl)methyl]-6-(4-octylsulfonylpiperazin-1-yl)pyrimidine |
| SMILES | CCCCCCCCS(=O)(=O)N1CCN(c2nc(C)nc(C)c2Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C26H40N4O2S/c1-5-6-7-8-9-10-19-33(31,32)30-17-15-29(16-18-30)26-25(22(3)27-23(4)28-26)20-24-13-11-21(2)12-14-24/h11-14H,5-10,15-20H2,1-4H3 |
| InChIKey | GAWXAGURHGLEBV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|