C23H33N5O4S — CID 83286328
2-butan-2-yl-4-methyl-5-[(4-nitrophenyl)methyl]-6-(4-propylsulfonylpiperazin-1-yl)pyrimidine (PubChem CID 83286328) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-butan-2-yl-4-methyl-5-[(4-nitrophenyl)methyl]-6-(4-propylsulfonylpiperazin-1-yl)pyrimidine.
| Compound Name | 2-butan-2-yl-4-methyl-5-[(4-nitrophenyl)methyl]-6-(4-propylsulfonylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 83286328 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-butan-2-yl-4-methyl-5-[(4-nitrophenyl)methyl]-6-(4-propylsulfonylpiperazin-1-yl)pyrimidine |
| SMILES | CCCS(=O)(=O)N1CCN(c2nc(C(C)CC)nc(C)c2Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H33N5O4S/c1-5-15-33(31,32)27-13-11-26(12-14-27)23-21(18(4)24-22(25-23)17(3)6-2)16-19-7-9-20(10-8-19)28(29)30/h7-10,17H,5-6,11-16H2,1-4H3 |
| InChIKey | WTWLMTJNQPNVJI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|